Difference between revisions of "PWY-5103"

Latest revision as of 10:58, 18 March 2021

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=HYDROXY-915-DIOXOPROSTA-13-ENOATE HYDROXY-915-DIOXOPROSTA-13-ENOATE] ==
+== Pathway PWY-5103 ==
+* taxonomic-range:
+** tax-1224
 * common-name:
-** 15-dehydro-prostaglandin e2
+** l-isoleucine biosynthesis iii
-* smiles:
+== Reaction(s) found ==
-** cccccc(=o)c=cc1(c(cc=ccccc(=o)[o-])c(=o)cc(o)1)
+* [[ACETOOHBUTREDUCTOISOM-RXN]]
-* inchi-key:
+* [[BRANCHED-CHAINAMINOTRANSFERILEU-RXN]]
-** yrtjdwrobkpznv-kmxmbppjsa-m
+* [[DIHYDROXYMETVALDEHYDRAT-RXN]]
-* molecular-weight:
+== Reaction(s) not found ==
-** 349.446
+* [NoneRXN-7751 RXN-7751]
-== Reaction(s) known to consume the compound ==
+* [NoneMETHYLASPARTATE-MUTASE-RXN METHYLASPARTATE-MUTASE-RXN]
-* [[1.1.1.141-RXN]]
+* [NoneRXN-7746 RXN-7746]
-== Reaction(s) known to produce the compound ==
+* [NoneACETOOHBUTSYN-RXN ACETOOHBUTSYN-RXN]
-* [[1.1.1.141-RXN]]
+{{#set: taxonomic-range=tax-1224}}
-== Reaction(s) of unknown directionality ==
+{{#set: common-name=l-isoleucine biosynthesis iii}}
-{{#set: common-name=15-dehydro-prostaglandin e2}}
+{{#set: nb reaction found=3}}
-{{#set: inchi-key=inchikey=yrtjdwrobkpznv-kmxmbppjsa-m}}
+{{#set: completion rate=0.43}}
-{{#set: molecular-weight=349.446}}
+{{#set: nb total reaction=7}}