Difference between revisions of "PWY-5103"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=HYDROXY-915-DIOXOPROSTA-13-ENOATE HYDROXY-915-DIOXOPROSTA-13-ENOATE] == * common-name: ** 15-de...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Steryl-Esters Steryl-Esters] == * common-name: ** a steryl-ester == Reaction(s) known to consum...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=HYDROXY-915-DIOXOPROSTA-13-ENOATE HYDROXY-915-DIOXOPROSTA-13-ENOATE] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Steryl-Esters Steryl-Esters] ==
 
* common-name:
 
* common-name:
** 15-dehydro-prostaglandin e2
+
** a steryl-ester
* smiles:
 
** cccccc(=o)c=cc1(c(cc=ccccc(=o)[o-])c(=o)cc(o)1)
 
* inchi-key:
 
** yrtjdwrobkpznv-kmxmbppjsa-m
 
* molecular-weight:
 
** 349.446
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[1.1.1.141-RXN]]
+
* [[STEROL-ESTERASE-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[1.1.1.141-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=15-dehydro-prostaglandin e2}}
+
{{#set: common-name=a steryl-ester}}
{{#set: inchi-key=inchikey=yrtjdwrobkpznv-kmxmbppjsa-m}}
 
{{#set: molecular-weight=349.446}}
 

Revision as of 09:22, 27 August 2019

Metabolite Steryl-Esters

  • common-name:
    • a steryl-ester

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality