Difference between revisions of "PWY-5107"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-3041 CPD-3041] == * common-name: ** isoliquiritigenin * smiles: ** c2(c=c(o)c=cc(c=cc(=o)c1...")
 
(Created page with "Category:pathway == Pathway PWY-5107 == * taxonomic-range: ** tax-3398 * common-name: ** phytol salvage pathway == Reaction(s) found == * RXN-7683 == Reaction(s) not f...")
 
(9 intermediate revisions by 5 users not shown)
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-3041 CPD-3041] ==
+
== Pathway PWY-5107 ==
 +
* taxonomic-range:
 +
** tax-3398
 
* common-name:
 
* common-name:
** isoliquiritigenin
+
** phytol salvage pathway
* smiles:
+
== Reaction(s) found ==
** c2(c=c(o)c=cc(c=cc(=o)c1(c(=cc(o)=cc=1)o))=2)
+
* [[RXN-7683]]
* inchi-key:
+
== Reaction(s) not found ==
** dxdrhhkmwqzjht-fpygclrlsa-n
+
* [NoneRXN-7763 RXN-7763]
* molecular-weight:
+
{{#set: taxonomic-range=tax-3398}}
** 256.257
+
{{#set: common-name=phytol salvage pathway}}
== Reaction(s) known to consume the compound ==
+
{{#set: nb reaction found=1}}
* [[RXN-3221]]
+
{{#set: completion rate=0.5}}
== Reaction(s) known to produce the compound ==
+
{{#set: nb total reaction=2}}
* [[RXN-3142]]
 
== Reaction(s) of unknown directionality ==
 
{{#set: common-name=isoliquiritigenin}}
 
{{#set: inchi-key=inchikey=dxdrhhkmwqzjht-fpygclrlsa-n}}
 
{{#set: molecular-weight=256.257}}
 

Latest revision as of 10:59, 18 March 2021

Pathway PWY-5107

  • taxonomic-range:
    • tax-3398
  • common-name:
    • phytol salvage pathway

Reaction(s) found

Reaction(s) not found

  • [NoneRXN-7763 RXN-7763]