Difference between revisions of "PWY-5108"

Latest revision as of 10:58, 18 March 2021

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=VANILLYL_MANDELATE VANILLYL_MANDELATE] ==
+== Pathway PWY-5108 ==
+* taxonomic-range:
+** tax-224756
+** tax-2
+** tax-183925
 * common-name:
-** vanillyl mandelate
+** l-isoleucine biosynthesis v
-* smiles:
+== Reaction(s) found ==
-** coc1(c(o)=cc=c(c=1)c(o)c(=o)[o-])
+* [[2KETO-3METHYLVALERATE-RXN]]
-* inchi-key:
+* [[BRANCHED-CHAINAMINOTRANSFERILEU-RXN]]
-** cgqcwmiaepehnq-mrvpvssysa-m
+== Reaction(s) not found ==
-* molecular-weight:
+* [NoneRXN-18448 RXN-18448]
-** 197.167
+* [NoneRXN-19503 RXN-19503]
-== Reaction(s) known to consume the compound ==
+{{#set: taxonomic-range=tax-224756|tax-2|tax-183925}}
-== Reaction(s) known to produce the compound ==
+{{#set: common-name=l-isoleucine biosynthesis v}}
-* [[RXN-10917]]
+{{#set: nb reaction found=2}}
-== Reaction(s) of unknown directionality ==
+{{#set: completion rate=0.67}}
-{{#set: common-name=vanillyl mandelate}}
+{{#set: nb total reaction=3}}
-{{#set: inchi-key=inchikey=cgqcwmiaepehnq-mrvpvssysa-m}}
-{{#set: molecular-weight=197.167}}