Difference between revisions of "PWY-5108"

Revision as of 20:16, 18 December 2020

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=VANILLYL_MANDELATE VANILLYL_MANDELATE] ==
+== Pathway PWY-7759 ==
+* taxonomic-range:
+** tax-191412
 * common-name:
-** vanillyl mandelate
+** bacteriochlorophyll c biosynthesis
-* smiles:
+== Reaction(s) found ==
-** coc1(c(o)=cc=c(c=1)c(o)c(=o)[o-])
+* [[RXN-5286]]
-* inchi-key:
+== Reaction(s) not found ==
-** cgqcwmiaepehnq-mrvpvssysa-m
+* [NoneRXN-17446 RXN-17446]
-* molecular-weight:
+* [NoneRXN-17432 RXN-17432]
-** 197.167
+* [NoneRXN-17447 RXN-17447]
-== Reaction(s) known to consume the compound ==
+* [NoneRXN-17491 RXN-17491]
-== Reaction(s) known to produce the compound ==
+* [NoneRXN-17435 RXN-17435]
-* [[RXN-10917]]
+* [NoneRXN-17445 RXN-17445]
-== Reaction(s) of unknown directionality ==
+* [NoneRXN-17443 RXN-17443]
-{{#set: common-name=vanillyl mandelate}}
+* [NoneRXN-17448 RXN-17448]
-{{#set: inchi-key=inchikey=cgqcwmiaepehnq-mrvpvssysa-m}}
+* [NoneRXN-17434 RXN-17434]
-{{#set: molecular-weight=197.167}}
+* [NoneRXN-17429 RXN-17429]
+* [NoneRXN-17430 RXN-17430]
+* [NoneRXN-17431 RXN-17431]
+* [NoneRXN-17441 RXN-17441]
+* [NoneRXN-17436 RXN-17436]
+* [NoneRXN-17444 RXN-17444]
+* [NoneRXN-17433 RXN-17433]
+* [NoneRXN-17442 RXN-17442]
+{{#set: taxonomic-range=tax-191412}}
+{{#set: common-name=bacteriochlorophyll c biosynthesis}}
+{{#set: nb reaction found=1}}
+{{#set: completion rate=0.06}}
+{{#set: nb total reaction=18}}