Difference between revisions of "PWY-5109"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-18437 CPD-18437] == * common-name: ** 3-hydroxy-4-methyl-anthranilate pentapeptide lactone...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=LIOTHYRONINE LIOTHYRONINE] == * common-name: ** 3,5,3'-triiodo-l-thyronine * smiles: ** c1(c=c(...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-18437 CPD-18437] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=LIOTHYRONINE LIOTHYRONINE] ==
 
* common-name:
 
* common-name:
** 3-hydroxy-4-methyl-anthranilate pentapeptide lactone
+
** 3,5,3'-triiodo-l-thyronine
 
* smiles:
 
* smiles:
** cc(c)c1(c(=o)n3([ch](c(n(c)cc(n(c(c(c)c)c(=o)oc(c)c(c(n1)=o)nc(=o)c2(c=cc(c)=c(c(n)=2)o))c)=o)=o)ccc3))
+
** c1(c=c(o)c(i)=cc=1oc2(=c(i)c=c(c=c(i)2)cc([n+])c(=o)[o-]))
 
* inchi-key:
 
* inchi-key:
** idanitfecicajb-mpkzyahhsa-n
+
** auyycjsjgjycds-lbprgkrzsa-n
 
* molecular-weight:
 
* molecular-weight:
** 630.74
+
** 650.978
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-17067]]
+
* [[RXN-10607]]
 +
* [[RXN-10609]]
 +
* [[RXN-10615]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=3-hydroxy-4-methyl-anthranilate pentapeptide lactone}}
+
{{#set: common-name=3,5,3'-triiodo-l-thyronine}}
{{#set: inchi-key=inchikey=idanitfecicajb-mpkzyahhsa-n}}
+
{{#set: inchi-key=inchikey=auyycjsjgjycds-lbprgkrzsa-n}}
{{#set: molecular-weight=630.74}}
+
{{#set: molecular-weight=650.978}}

Revision as of 14:18, 26 August 2019

Metabolite LIOTHYRONINE

  • common-name:
    • 3,5,3'-triiodo-l-thyronine
  • smiles:
    • c1(c=c(o)c(i)=cc=1oc2(=c(i)c=c(c=c(i)2)cc([n+])c(=o)[o-]))
  • inchi-key:
    • auyycjsjgjycds-lbprgkrzsa-n
  • molecular-weight:
    • 650.978

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality