Difference between revisions of "PWY-5109"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=LIOTHYRONINE LIOTHYRONINE] == * common-name: ** 3,5,3'-triiodo-l-thyronine * smiles: ** c1(c=c(...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=IMP IMP] == * common-name: ** imp * smiles: ** c(op(=o)([o-])[o-])c1(oc(c(o)c(o)1)n3(c=nc2(c(=o...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=LIOTHYRONINE LIOTHYRONINE] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=IMP IMP] ==
 
* common-name:
 
* common-name:
** 3,5,3'-triiodo-l-thyronine
+
** imp
 
* smiles:
 
* smiles:
** c1(c=c(o)c(i)=cc=1oc2(=c(i)c=c(c=c(i)2)cc([n+])c(=o)[o-]))
+
** c(op(=o)([o-])[o-])c1(oc(c(o)c(o)1)n3(c=nc2(c(=o)nc=nc=23)))
 
* inchi-key:
 
* inchi-key:
** auyycjsjgjycds-lbprgkrzsa-n
+
** grszfwquakgdav-kqynxxcusa-l
 
* molecular-weight:
 
* molecular-weight:
** 650.978
+
** 346.193
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-10607]]
+
* [[ADENYLOSUCCINATE-SYNTHASE-RXN]]
* [[RXN-10609]]
+
* [[HPRT]]
* [[RXN-10615]]
+
* [[I5NT]]
 +
* [[IMP-DEHYDROG-RXN]]
 +
* [[IMPCYCLOHYDROLASE-RXN]]
 +
* [[RXN-7607]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[AMP-DEAMINASE-RXN]]
 +
* [[GMP-REDUCT-RXN]]
 +
* [[HPRT]]
 +
* [[HYPOXANPRIBOSYLTRAN-RXN]]
 +
* [[IMP-DEHYDROG-RXN]]
 +
* [[IMPCYCLOHYDROLASE-RXN]]
 +
* [[ITPP]]
 +
* [[RXN-14003]]
 +
* [[RXN0-6382]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=3,5,3'-triiodo-l-thyronine}}
+
{{#set: common-name=imp}}
{{#set: inchi-key=inchikey=auyycjsjgjycds-lbprgkrzsa-n}}
+
{{#set: inchi-key=inchikey=grszfwquakgdav-kqynxxcusa-l}}
{{#set: molecular-weight=650.978}}
+
{{#set: molecular-weight=346.193}}

Revision as of 09:22, 27 August 2019

Metabolite IMP

  • common-name:
    • imp
  • smiles:
    • c(op(=o)([o-])[o-])c1(oc(c(o)c(o)1)n3(c=nc2(c(=o)nc=nc=23)))
  • inchi-key:
    • grszfwquakgdav-kqynxxcusa-l
  • molecular-weight:
    • 346.193

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality