Difference between revisions of "PWY-5109"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=IMP IMP] == * common-name: ** imp * smiles: ** c(op(=o)([o-])[o-])c1(oc(c(o)c(o)1)n3(c=nc2(c(=o...")
(Created page with "Category:pathway == Pathway CALVIN-PWY == <div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;"> * taxonomic-range: ** tax-1117 ** tax-391...")
Line 1: Line 1:
−
[[Category:metabolite]]
+
[[Category:pathway]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=IMP IMP] ==
+
== Pathway CALVIN-PWY ==
 +
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
 +
* taxonomic-range:
 +
** tax-1117
 +
** tax-39119
 +
** tax-38254
 +
** tax-29197
 +
** tax-38410
 +
** tax-5747
 +
** tax-2864
 +
** tax-877183
 +
** tax-2836
 +
** tax-3027
 +
** tax-2830
 +
** tax-2833
 +
** tax-3041
 +
** tax-33682
 +
** tax-2763
 +
** tax-2870
 +
** tax-2825
 +
** tax-2
 +
** tax-33090
 
* common-name:
 
* common-name:
−
** imp
+
** calvin-benson-bassham cycle
−
* smiles:
+
</div>
−
** c(op(=o)([o-])[o-])c1(oc(c(o)c(o)1)n3(c=nc2(c(=o)nc=nc=23)))
+
== Reaction(s) found ==
−
* inchi-key:
+
* [[1TRANSKETO-RXN]]
−
** grszfwquakgdav-kqynxxcusa-l
+
* [[2TRANSKETO-RXN]]
−
* molecular-weight:
+
* [[F16ALDOLASE-RXN]]
−
** 346.193
+
* [[F16BDEPHOS-RXN]]
−
== Reaction(s) known to consume the compound ==
+
* [[PHOSGLYPHOS-RXN]]
−
* [[ADENYLOSUCCINATE-SYNTHASE-RXN]]
+
* [[PHOSPHORIBULOKINASE-RXN]]
−
* [[HPRT]]
+
* [[RIB5PISOM-RXN]]
−
* [[I5NT]]
+
* [[RIBULOSE-BISPHOSPHATE-CARBOXYLASE-RXN]]
−
* [[IMP-DEHYDROG-RXN]]
+
* [[RIBULP3EPIM-RXN]]
−
* [[IMPCYCLOHYDROLASE-RXN]]
+
* [[SEDOBISALDOL-RXN]]
−
* [[RXN-7607]]
+
* [[SEDOHEPTULOSE-BISPHOSPHATASE-RXN]]
−
== Reaction(s) known to produce the compound ==
+
* [[TRIOSEPISOMERIZATION-RXN]]
−
* [[AMP-DEAMINASE-RXN]]
+
== Reaction(s) not found ==
−
* [[GMP-REDUCT-RXN]]
+
* [None1.2.1.13-RXN 1.2.1.13-RXN]
−
* [[HPRT]]
+
{{#set: taxonomic-range=tax-877183|tax-2836|tax-2833|tax-29197|tax-3041|tax-39119|tax-5747|tax-2870|tax-33682|tax-2|tax-2825|tax-2864|tax-33090|tax-38410|tax-3027|tax-2763|tax-38254|tax-1117|tax-2830}}
−
* [[HYPOXANPRIBOSYLTRAN-RXN]]
+
{{#set: common-name=calvin-benson-bassham cycle}}
−
* [[IMP-DEHYDROG-RXN]]
+
{{#set: nb reaction found=12}}
−
* [[IMPCYCLOHYDROLASE-RXN]]
+
{{#set: completion rate=0.92}}
−
* [[ITPP]]
+
{{#set: nb total reaction=13}}
−
* [[RXN-14003]]
 
−
* [[RXN0-6382]]
 
−
== Reaction(s) of unknown directionality ==
 
−
{{#set: common-name=imp}}
 
−
{{#set: inchi-key=inchikey=grszfwquakgdav-kqynxxcusa-l}}
 
−
{{#set: molecular-weight=346.193}}
 

Revision as of 20:16, 18 December 2020

Pathway CALVIN-PWY

  • taxonomic-range:
    • tax-1117
    • tax-39119
    • tax-38254
    • tax-29197
    • tax-38410
    • tax-5747
    • tax-2864
    • tax-877183
    • tax-2836
    • tax-3027
    • tax-2830
    • tax-2833
    • tax-3041
    • tax-33682
    • tax-2763
    • tax-2870
    • tax-2825
    • tax-2
    • tax-33090
  • common-name:
    • calvin-benson-bassham cycle

Reaction(s) found

Reaction(s) not found

  • [None1.2.1.13-RXN 1.2.1.13-RXN]



Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=PWY-5109&oldid=39499"