Difference between revisions of "PWY-5115"

Revision as of 20:18, 18 December 2020

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CAFFEOYL-COA CAFFEOYL-COA] ==
+== Pathway PWY-7591 ==
+* taxonomic-range:
+** tax-1046
 * common-name:
-** trans-caffeoyl-coa
+** okenone biosynthesis
-* smiles:
+== Reaction(s) found ==
-** cc(c)(c(o)c(=o)nccc(=o)nccsc(=o)c=cc1(=cc=c(o)c(=c1)o))cop(=o)(op(=o)(occ2(c(op([o-])(=o)[o-])c(o)c(o2)n4(c3(=c(c(n)=nc=n3)n=c4))))[o-])[o-]
+* [[RXN1F-150]]
-* inchi-key:
+== Reaction(s) not found ==
-** qhrgjmimhclhrg-zseliehesa-j
+* [NoneRXN-12412 RXN-12412]
-* molecular-weight:
+* [NoneRXN-16056 RXN-16056]
-** 925.647
+* [NoneRXN-16057 RXN-16057]
-== Reaction(s) known to consume the compound ==
+* [NoneRXN-16058 RXN-16058]
-* [[CAFFEOYL-COA-O-METHYLTRANSFERASE-RXN]]
+* [NoneRXN-16055 RXN-16055]
-== Reaction(s) known to produce the compound ==
+{{#set: taxonomic-range=tax-1046}}
-* [[RXN-1126]]
+{{#set: common-name=okenone biosynthesis}}
-== Reaction(s) of unknown directionality ==
+{{#set: nb reaction found=1}}
-{{#set: common-name=trans-caffeoyl-coa}}
+{{#set: completion rate=0.17}}
-{{#set: inchi-key=inchikey=qhrgjmimhclhrg-zseliehesa-j}}
+{{#set: nb total reaction=6}}
-{{#set: molecular-weight=925.647}}