Difference between revisions of "PWY-5120"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CDP-2-3-4-Saturated-Diacylglycerols CDP-2-3-4-Saturated-Diacylglycerols] == * common-name: ** a...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPDQT-36 CPDQT-36] == * common-name: ** 3-[(3'-methylthio)propyl]malate * smiles: ** c(c(cccsc)...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPDQT-36 CPDQT-36] == |
* common-name: | * common-name: | ||
| − | ** | + | ** 3-[(3'-methylthio)propyl]malate |
| + | * smiles: | ||
| + | ** c(c(cccsc)c(o)c(=o)[o-])(=o)[o-] | ||
| + | * inchi-key: | ||
| + | ** sqxviiopmysncp-uhfffaoysa-l | ||
| + | * molecular-weight: | ||
| + | ** 220.24 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[RXN-18208]] | ||
| + | * [[RXNQT-4165]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN-18208]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=3-[(3'-methylthio)propyl]malate}} |
| + | {{#set: inchi-key=inchikey=sqxviiopmysncp-uhfffaoysa-l}} | ||
| + | {{#set: molecular-weight=220.24}} | ||
Revision as of 09:22, 27 August 2019
Contents
Metabolite CPDQT-36
- common-name:
- 3-[(3'-methylthio)propyl]malate
- smiles:
- c(c(cccsc)c(o)c(=o)[o-])(=o)[o-]
- inchi-key:
- sqxviiopmysncp-uhfffaoysa-l
- molecular-weight:
- 220.24
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
Property "Common-name" (as page type) with input value "3-[(3'-methylthio)propyl]malate" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.
