Difference between revisions of "PWY-5123"

Revision as of 20:19, 18 December 2020

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CARBOXYPHENYLAMINO-DEOXYRIBULOSE-P CARBOXYPHENYLAMINO-DEOXYRIBULOSE-P] ==
+== Pathway PWY-7297 ==
+* taxonomic-range:
+** tax-33317
+** tax-7735
+** tax-6157
+** tax-7586
 * common-name:
-** 1-(o-carboxyphenylamino)-1'-deoxyribulose 5'-phosphate
+** octopamine biosynthesis
-* smiles:
+== Reaction(s) found ==
-** c(op(=o)([o-])[o-])c(o)c(o)c(=o)cnc1(c=cc=cc(c(=o)[o-])=1)
+* [[TYROSINE-DECARBOXYLASE-RXN]]
-* inchi-key:
+== Reaction(s) not found ==
-** qkmbynrmprkvto-mnovxskesa-k
+* [NoneRXN-14645 RXN-14645]
-* molecular-weight:
+{{#set: taxonomic-range=tax-7735|tax-6157|tax-7586|tax-33317}}
-** 346.21
+{{#set: common-name=octopamine biosynthesis}}
-== Reaction(s) known to consume the compound ==
+{{#set: nb reaction found=1}}
-* [[IGPSYN-RXN]]
+{{#set: completion rate=0.5}}
-== Reaction(s) known to produce the compound ==
+{{#set: nb total reaction=2}}
-* [[PRAISOM-RXN]]
-== Reaction(s) of unknown directionality ==
-{{#set: common-name=1-(o-carboxyphenylamino)-1'-deoxyribulose 5'-phosphate}}
-{{#set: inchi-key=inchikey=qkmbynrmprkvto-mnovxskesa-k}}
-{{#set: molecular-weight=346.21}}