Difference between revisions of "PWY-5123"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13613 CPD-13613] == * common-name: ** l-threo-sphinganine * smiles: ** cccccccccccccccc(c(c...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CARBOXYPHENYLAMINO-DEOXYRIBULOSE-P CARBOXYPHENYLAMINO-DEOXYRIBULOSE-P] == * common-name: ** 1-(...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CARBOXYPHENYLAMINO-DEOXYRIBULOSE-P CARBOXYPHENYLAMINO-DEOXYRIBULOSE-P] == |
* common-name: | * common-name: | ||
| − | ** | + | ** 1-(o-carboxyphenylamino)-1'-deoxyribulose 5'-phosphate |
* smiles: | * smiles: | ||
| − | ** | + | ** c(op(=o)([o-])[o-])c(o)c(o)c(=o)cnc1(c=cc=cc(c(=o)[o-])=1) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** qkmbynrmprkvto-mnovxskesa-k |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 346.21 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN | + | * [[IGPSYN-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN | + | * [[PRAISOM-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=1-(o-carboxyphenylamino)-1'-deoxyribulose 5'-phosphate}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=qkmbynrmprkvto-mnovxskesa-k}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=346.21}} |
Revision as of 09:23, 27 August 2019
Contents
Metabolite CARBOXYPHENYLAMINO-DEOXYRIBULOSE-P
- common-name:
- 1-(o-carboxyphenylamino)-1'-deoxyribulose 5'-phosphate
- smiles:
- c(op(=o)([o-])[o-])c(o)c(o)c(=o)cnc1(c=cc=cc(c(=o)[o-])=1)
- inchi-key:
- qkmbynrmprkvto-mnovxskesa-k
- molecular-weight:
- 346.21
