Difference between revisions of "PWY-5132"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=5Z8Z11Z13E-15S-15-HYDROPEROXYICOS 5Z8Z11Z13E-15S-15-HYDROPEROXYICOS] == * common-name: ** (15s)...")
 
(Created page with "Category:pathway == Pathway PWY-5132 == * taxonomic-range: ** tax-3481 * common-name: ** lupulone and humulone biosynthesis == Reaction(s) found == * RXN-7810 * RXN-...")
 
(9 intermediate revisions by 5 users not shown)
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=5Z8Z11Z13E-15S-15-HYDROPEROXYICOS 5Z8Z11Z13E-15S-15-HYDROPEROXYICOS] ==
+
== Pathway PWY-5132 ==
 +
* taxonomic-range:
 +
** tax-3481
 
* common-name:
 
* common-name:
** (15s)-hpete
+
** lupulone and humulone biosynthesis
* smiles:
+
== Reaction(s) found ==
** cccccc(oo)c=cc=ccc=ccc=ccccc(=o)[o-]
+
* [[RXN-7810]]
* inchi-key:
+
* [[RXN-7811]]
** bfwytordsfivkp-vaeksgalsa-m
+
== Reaction(s) not found ==
* molecular-weight:
+
* [NoneRXN-7807 RXN-7807]
** 335.462
+
* [NoneRXN-18446 RXN-18446]
== Reaction(s) known to consume the compound ==
+
* [None2.3.1.156-RXN 2.3.1.156-RXN]
== Reaction(s) known to produce the compound ==
+
* [NoneRXN-18441 RXN-18441]
* [[ARACHIDONATE-15-LIPOXYGENASE-RXN]]
+
{{#set: taxonomic-range=tax-3481}}
== Reaction(s) of unknown directionality ==
+
{{#set: common-name=lupulone and humulone biosynthesis}}
{{#set: common-name=(15s)-hpete}}
+
{{#set: nb reaction found=2}}
{{#set: inchi-key=inchikey=bfwytordsfivkp-vaeksgalsa-m}}
+
{{#set: completion rate=0.33}}
{{#set: molecular-weight=335.462}}
+
{{#set: nb total reaction=6}}

Latest revision as of 11:00, 18 March 2021

Pathway PWY-5132

  • taxonomic-range:
    • tax-3481
  • common-name:
    • lupulone and humulone biosynthesis

Reaction(s) found

Reaction(s) not found

  • [NoneRXN-7807 RXN-7807]
  • [NoneRXN-18446 RXN-18446]
  • [None2.3.1.156-RXN 2.3.1.156-RXN]
  • [NoneRXN-18441 RXN-18441]