Difference between revisions of "PWY-5137"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10660 CPD-10660] == * common-name: ** 3-chlorobenzaldehyde * smiles: ** c(=o)c1(c=cc=c(cl)c...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15651 CPD-15651] == * common-name: ** 6-trans-tridecenoyl-coa * smiles: ** ccccccc=cccccc(=...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10660 CPD-10660] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15651 CPD-15651] ==
 
* common-name:
 
* common-name:
** 3-chlorobenzaldehyde
+
** 6-trans-tridecenoyl-coa
 
* smiles:
 
* smiles:
** c(=o)c1(c=cc=c(cl)c=1)
+
** ccccccc=cccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 
* inchi-key:
 
* inchi-key:
** srwilaksarhzpr-uhfffaoysa-n
+
** uuivzebypbpkll-hmxwsvnbsa-j
 
* molecular-weight:
 
* molecular-weight:
** 140.569
+
** 957.819
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-9910]]
+
* [[RXN-14785]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=3-chlorobenzaldehyde}}
+
{{#set: common-name=6-trans-tridecenoyl-coa}}
{{#set: inchi-key=inchikey=srwilaksarhzpr-uhfffaoysa-n}}
+
{{#set: inchi-key=inchikey=uuivzebypbpkll-hmxwsvnbsa-j}}
{{#set: molecular-weight=140.569}}
+
{{#set: molecular-weight=957.819}}

Revision as of 14:18, 26 August 2019

Metabolite CPD-15651

  • common-name:
    • 6-trans-tridecenoyl-coa
  • smiles:
    • ccccccc=cccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
  • inchi-key:
    • uuivzebypbpkll-hmxwsvnbsa-j
  • molecular-weight:
    • 957.819

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality