Difference between revisions of "PWY-5152"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10576 CPD-10576] == * common-name: ** 4-chlorosalicylate * smiles: ** c(c1(c=cc(cl)=cc=1o))...")
 
(Created page with "Category:pathway == Pathway PWY-5152 == * taxonomic-range: ** tax-58024 * common-name: ** leucodelphinidin biosynthesis == Reaction(s) found == * RXN-7784 * RXN-7922...")
 
(9 intermediate revisions by 4 users not shown)
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10576 CPD-10576] ==
+
== Pathway PWY-5152 ==
 +
* taxonomic-range:
 +
** tax-58024
 
* common-name:
 
* common-name:
** 4-chlorosalicylate
+
** leucodelphinidin biosynthesis
* smiles:
+
== Reaction(s) found ==
** c(c1(c=cc(cl)=cc=1o))([o-])=o
+
* [[RXN-7784]]
* inchi-key:
+
* [[RXN-7922]]
** lwxfczxrfbuoor-uhfffaoysa-m
+
== Reaction(s) not found ==
* molecular-weight:
+
* [NoneRXN-7921 RXN-7921]
** 171.56
+
* [NoneRXN-13718 RXN-13718]
== Reaction(s) known to consume the compound ==
+
* [NoneRXN-525 RXN-525]
* [[RXN-9912]]
+
{{#set: taxonomic-range=tax-58024}}
== Reaction(s) known to produce the compound ==
+
{{#set: common-name=leucodelphinidin biosynthesis}}
== Reaction(s) of unknown directionality ==
+
{{#set: nb reaction found=2}}
{{#set: common-name=4-chlorosalicylate}}
+
{{#set: completion rate=0.4}}
{{#set: inchi-key=inchikey=lwxfczxrfbuoor-uhfffaoysa-m}}
+
{{#set: nb total reaction=5}}
{{#set: molecular-weight=171.56}}
 

Latest revision as of 10:59, 18 March 2021

Pathway PWY-5152

  • taxonomic-range:
    • tax-58024
  • common-name:
    • leucodelphinidin biosynthesis

Reaction(s) found

Reaction(s) not found

  • [NoneRXN-7921 RXN-7921]
  • [NoneRXN-13718 RXN-13718]
  • [NoneRXN-525 RXN-525]