Difference between revisions of "PWY-5168"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SHIKIMATE-5P SHIKIMATE-5P] == * common-name: ** shikimate 3-phosphate * smiles: ** c(=o)([o-])c...")
 
(Created page with "Category:pathway == Pathway PWY-5168 == * taxonomic-range: ** tax-58024 * common-name: ** ferulate and sinapate biosynthesis == Reaction(s) found == * RXN-1143 * RXN...")
 
(9 intermediate revisions by 5 users not shown)
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SHIKIMATE-5P SHIKIMATE-5P] ==
+
== Pathway PWY-5168 ==
 +
* taxonomic-range:
 +
** tax-58024
 
* common-name:
 
* common-name:
** shikimate 3-phosphate
+
** ferulate and sinapate biosynthesis
* smiles:
+
== Reaction(s) found ==
** c(=o)([o-])c1(=cc(op(=o)([o-])[o-])c(o)c(o)c1)
+
* [[RXN-1143]]
* inchi-key:
+
* [[RXN-8014]]
** qyojskgcwnakgw-pbxrrbtrsa-k
+
== Reaction(s) not found ==
* molecular-weight:
+
* [NoneRXN-1142 RXN-1142]
** 251.109
+
* [NoneRXN-1241 RXN-1241]
== Reaction(s) known to consume the compound ==
+
{{#set: taxonomic-range=tax-58024}}
* [[2.5.1.19-RXN]]
+
{{#set: common-name=ferulate and sinapate biosynthesis}}
* [[SHIKIMATE-KINASE-RXN]]
+
{{#set: nb reaction found=2}}
== Reaction(s) known to produce the compound ==
+
{{#set: completion rate=0.5}}
* [[2.5.1.19-RXN]]
+
{{#set: nb total reaction=4}}
* [[SHIKIMATE-KINASE-RXN]]
 
== Reaction(s) of unknown directionality ==
 
{{#set: common-name=shikimate 3-phosphate}}
 
{{#set: inchi-key=inchikey=qyojskgcwnakgw-pbxrrbtrsa-k}}
 
{{#set: molecular-weight=251.109}}
 

Latest revision as of 10:57, 18 March 2021

Pathway PWY-5168

  • taxonomic-range:
    • tax-58024
  • common-name:
    • ferulate and sinapate biosynthesis

Reaction(s) found

Reaction(s) not found

  • [NoneRXN-1142 RXN-1142]
  • [NoneRXN-1241 RXN-1241]