Difference between revisions of "PWY-5168"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SHIKIMATE-5P SHIKIMATE-5P] == * common-name: ** shikimate 3-phosphate * smiles: ** c(=o)([o-])c...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=LC-alcohol-LC-acyl-ester LC-alcohol-LC-acyl-ester] == * common-name: ** a long-chain alcohol--l...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SHIKIMATE-5P SHIKIMATE-5P] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=LC-alcohol-LC-acyl-ester LC-alcohol-LC-acyl-ester] ==
 
* common-name:
 
* common-name:
** shikimate 3-phosphate
+
** a long-chain alcohol--long-chain acyl wax ester
* smiles:
 
** c(=o)([o-])c1(=cc(op(=o)([o-])[o-])c(o)c(o)c1)
 
* inchi-key:
 
** qyojskgcwnakgw-pbxrrbtrsa-k
 
* molecular-weight:
 
** 251.109
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[2.5.1.19-RXN]]
 
* [[SHIKIMATE-KINASE-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[2.5.1.19-RXN]]
+
* [[2.3.1.75-RXN]]
* [[SHIKIMATE-KINASE-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=shikimate 3-phosphate}}
+
{{#set: common-name=a long-chain alcohol--long-chain acyl wax ester}}
{{#set: inchi-key=inchikey=qyojskgcwnakgw-pbxrrbtrsa-k}}
 
{{#set: molecular-weight=251.109}}
 

Revision as of 14:18, 26 August 2019

Metabolite LC-alcohol-LC-acyl-ester

  • common-name:
    • a long-chain alcohol--long-chain acyl wax ester

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality