Difference between revisions of "PWY-5169"

Latest revision as of 11:00, 18 March 2021

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-474 CPD-474] ==
+== Pathway PWY-5169 ==
+* taxonomic-range:
+** tax-4751
+** tax-1224
 * common-name:
-** (+)-taxifolin
+** cyanurate degradation
-* smiles:
+== Reaction(s) found ==
-** c1(c=c(o)c(o)=cc=1c2(oc3(c=c([o-])c=c(o)c(c(=o)c(o)2)=3)))
+* [[ALLOPHANATE-HYDROLASE-RXN]]
-* inchi-key:
+== Reaction(s) not found ==
-** cxqwrcvtcmqvqx-lsdhhaiusa-m
+* [NoneRXN-8930 RXN-8930]
-* molecular-weight:
+* [NoneRXN-20066 RXN-20066]
-** 303.248
+* [NoneRXN-20065 RXN-20065]
-== Reaction(s) known to consume the compound ==
+* [NoneRXN0-5222 RXN0-5222]
-* [[RXN-527]]
+* [NoneRXN-20062 RXN-20062]
-* [[RXN-600]]
+{{#set: taxonomic-range=tax-4751|tax-1224}}
-== Reaction(s) known to produce the compound ==
+{{#set: common-name=cyanurate degradation}}
-* [[RXN-7775]]
+{{#set: nb reaction found=1}}
-== Reaction(s) of unknown directionality ==
+{{#set: completion rate=0.2}}
-{{#set: common-name=(+)-taxifolin}}
+{{#set: nb total reaction=5}}
-{{#set: inchi-key=inchikey=cxqwrcvtcmqvqx-lsdhhaiusa-m}}
-{{#set: molecular-weight=303.248}}