Difference between revisions of "PWY-5169"

Revision as of 20:18, 18 December 2020

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-474 CPD-474] ==
+== Pathway GALACTCAT-PWY ==
+* taxonomic-range:
+** tax-2157
+** tax-2
 * common-name:
-** (+)-taxifolin
+** d-galactonate degradation
-* smiles:
+== Reaction(s) found ==
-** c1(c=c(o)c(o)=cc=1c2(oc3(c=c([o-])c=c(o)c(c(=o)c(o)2)=3)))
+* [[DEHYDDEOXPHOSGALACT-ALDOL-RXN]]
-* inchi-key:
+== Reaction(s) not found ==
-** cxqwrcvtcmqvqx-lsdhhaiusa-m
+* [NoneDEHYDDEOXGALACTKIN-RXN DEHYDDEOXGALACTKIN-RXN]
-* molecular-weight:
+* [NoneGALACTONDEHYDRAT-RXN GALACTONDEHYDRAT-RXN]
-** 303.248
+{{#set: taxonomic-range=tax-2|tax-2157}}
-== Reaction(s) known to consume the compound ==
+{{#set: common-name=d-galactonate degradation}}
-* [[RXN-527]]
+{{#set: nb reaction found=1}}
-* [[RXN-600]]
+{{#set: completion rate=0.33}}
-== Reaction(s) known to produce the compound ==
+{{#set: nb total reaction=3}}
-* [[RXN-7775]]
-== Reaction(s) of unknown directionality ==
-{{#set: common-name=(+)-taxifolin}}
-{{#set: inchi-key=inchikey=cxqwrcvtcmqvqx-lsdhhaiusa-m}}
-{{#set: molecular-weight=303.248}}