Difference between revisions of "PWY-5172"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=7-METHYLXANTHINE 7-METHYLXANTHINE] == * common-name: ** 7-methylxanthine * smiles: ** cn1(c=nc2...")
 
(Created page with "{{#ask: Category:reaction reconstruction tool::pantograph | ?common-name | ?ec-number | ?reconstruction category | ?reconstruction source | ?reconstruction comment | ?...")
Line 1: Line 1:
−
[[Category:metabolite]]
+
{{#ask: [[Category:reaction]] [[reconstruction tool::pantograph]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=7-METHYLXANTHINE 7-METHYLXANTHINE] ==
+
| ?common-name
−
* common-name:
+
| ?ec-number
−
** 7-methylxanthine
+
| ?reconstruction category
−
* smiles:
+
| ?reconstruction source
−
** cn1(c=nc2(nc(=o)nc(=o)c1=2))
+
| ?reconstruction comment
−
* inchi-key:
+
| ?nb gene associated
−
** pfwlfwpasulgan-uhfffaoysa-n
+
| ?nb pathway associated
−
* molecular-weight:
+
}}
−
** 166.139
 
−
== Reaction(s) known to consume the compound ==
 
−
* [[RXN-11521]]
 
−
== Reaction(s) known to produce the compound ==
 
−
== Reaction(s) of unknown directionality ==
 
−
{{#set: common-name=7-methylxanthine}}
 
−
{{#set: inchi-key=inchikey=pfwlfwpasulgan-uhfffaoysa-n}}
 
−
{{#set: molecular-weight=166.139}}
 

Revision as of 14:18, 26 August 2019

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=PWY-5172&oldid=13079"