Difference between revisions of "PWY-5174"

Revision as of 14:18, 26 August 2019

@@ Line 1: / Line 1: @@
 [[Category:metabolite]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12826 CPD-12826] ==
+== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CARBAMOYL-P CARBAMOYL-P] ==
 * common-name:
-** folate
+** carbamoyl phosphate
 * smiles:
-** c(nc1(c=cc(c(=o)nc(c(=o)[o-])ccc([o-])=o)=cc=1))c2(c=nc3(n=c(n)nc(=o)c(n=2)=3))
+** c(=o)(n)op(=o)([o-])[o-]
 * inchi-key:
-** ovbpiulpvideao-lbprgkrzsa-l
+** ffqkyprqeygkaf-uhfffaoysa-l
 * molecular-weight:
-** 439.387
+** 139.004
 == Reaction(s) known to consume the compound ==
-* [[DHFOR]]
+* [[ASPCARBTRANS-RXN]]
-* [[FOLR2]]
+* [[ORNCARBAMTRANSFER-RXN]]
-* [[THFOR1]]
+* [[RXN-13482]]
-* [[THFOR2]]
+* [[RXN-14552]]
+* [[RXN-15284]]
+* [[RXN-15285]]
+* [[RXN-15287]]
+* [[RXN-9]]
 == Reaction(s) known to produce the compound ==
+* [[ASPCARBTRANS-RXN]]
+* [[CARBPSYN-RXN]]
+* [[ORNCARBAMTRANSFER-RXN]]
+* [[RXN-13202]]
+* [[RXN-13482]]
+* [[RXN-14196]]
 == Reaction(s) of unknown directionality ==
-{{#set: common-name=folate}}
+{{#set: common-name=carbamoyl phosphate}}
-{{#set: inchi-key=inchikey=ovbpiulpvideao-lbprgkrzsa-l}}
+{{#set: inchi-key=inchikey=ffqkyprqeygkaf-uhfffaoysa-l}}
-{{#set: molecular-weight=439.387}}
+{{#set: molecular-weight=139.004}}