Difference between revisions of "PWY-5176"

Revision as of 14:19, 26 August 2019

@@ Line 1: / Line 1: @@
 [[Category:metabolite]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-2107 CPD0-2107] ==
+== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Purine-Bases Purine-Bases] ==
 * common-name:
-** (s)-3-hydroxydodecanoyl-coa
+** a purine base
-* smiles:
-** cccccccccc(o)cc(=o)sccnc(=o)ccnc(c(o)c(c)(c)cop([o-])(=o)op([o-])(=o)occ1(c(op(=o)([o-])[o-])c(o)c(o1)n3(c=nc2(c(n)=nc=nc=23))))=o
-* inchi-key:
-** ijflxrcjwpkgkj-lxixeqkwsa-j
-* molecular-weight:
-** 961.807
 == Reaction(s) known to consume the compound ==
-* [[ECOAH5]]
+* [[PNP-RXN]]
-* [[ECOAH5h]]
+* [[RXN-14029]]
-* [[ECOAH5m]]
-* [[HACD5]]
-* [[HACD5h]]
-* [[HACD5m]]
 == Reaction(s) known to produce the compound ==
-* [[ECOAH5]]
+* [[PNP-RXN]]
-* [[ECOAH5h]]
+* [[PURINE-NUCLEOSIDASE-RXN]]
-* [[ECOAH5m]]
+* [[RXN-14029]]
-* [[HACD5]]
+* [[RXN-7001]]
-* [[HACD5h]]
-* [[HACD5m]]
 == Reaction(s) of unknown directionality ==
-{{#set: common-name=(s)-3-hydroxydodecanoyl-coa}}
+{{#set: common-name=a purine base}}
-{{#set: inchi-key=inchikey=ijflxrcjwpkgkj-lxixeqkwsa-j}}
-{{#set: molecular-weight=961.807}}