Difference between revisions of "PWY-5196"

Latest revision as of 10:58, 18 March 2021

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=NOREPINEPHRINE NOREPINEPHRINE] ==
+== Pathway PWY-5196 ==
+* taxonomic-range:
+** tax-224756
+** tax-183939
+** tax-183925
 * common-name:
-** (r)-noradrenaline
+** factor 430 biosynthesis
-* smiles:
+== Reaction(s) found ==
-** c1(c=c(o)c(=cc=1c(c[n+])o)o)
+* [[DIMETHUROPORDEHYDROG-RXN]]
-* inchi-key:
+* [[RXN-8675]]
-** sflshlfxelfnjz-qmmmgpobsa-o
+* [[UROPORIIIMETHYLTRANSA-RXN]]
-* molecular-weight:
+== Reaction(s) not found ==
-** 170.188
+* [NoneRXN-8060 RXN-8060]
-== Reaction(s) known to consume the compound ==
+* [NoneRXN-8061 RXN-8061]
-* [[RXN-10907]]
+* [NoneRXN-8059 RXN-8059]
-== Reaction(s) known to produce the compound ==
+* [NoneRXN-8063 RXN-8063]
-* [[DOPAMINE-BETA-MONOOXYGENASE-RXN]]
+{{#set: taxonomic-range=tax-224756|tax-183939|tax-183925}}
-== Reaction(s) of unknown directionality ==
+{{#set: common-name=factor 430 biosynthesis}}
-{{#set: common-name=(r)-noradrenaline}}
+{{#set: nb reaction found=3}}
-{{#set: inchi-key=inchikey=sflshlfxelfnjz-qmmmgpobsa-o}}
+{{#set: completion rate=0.43}}
-{{#set: molecular-weight=170.188}}
+{{#set: nb total reaction=7}}