Difference between revisions of "PWY-5196"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11647 CPD-11647] == * common-name: ** thermospermine * smiles: ** c([n+])ccc[n+]ccc[n+]ccc[...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17050 CPD-17050] == * common-name: ** 3-benzyl-3,6 -disulfide-6-(hydroxymethyl)-diketopiper...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD- | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17050 CPD-17050] == |
* common-name: | * common-name: | ||
| − | ** | + | ** 3-benzyl-3,6 -disulfide-6-(hydroxymethyl)-diketopiperazine |
* smiles: | * smiles: | ||
| − | ** c( | + | ** c(o)c23(ssc(cc1(=cc=cc=c1))(nc(=o)2)c(=o)n3) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** poiijaagmgnxlo-vxgbxaggsa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 296.358 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[RXN-15684]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=3-benzyl-3,6 -disulfide-6-(hydroxymethyl)-diketopiperazine}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=poiijaagmgnxlo-vxgbxaggsa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=296.358}} |
Revision as of 14:18, 26 August 2019
Contents
Metabolite CPD-17050
- common-name:
- 3-benzyl-3,6 -disulfide-6-(hydroxymethyl)-diketopiperazine
- smiles:
- c(o)c23(ssc(cc1(=cc=cc=c1))(nc(=o)2)c(=o)n3)
- inchi-key:
- poiijaagmgnxlo-vxgbxaggsa-n
- molecular-weight:
- 296.358
