Difference between revisions of "PWY-5196"

Revision as of 20:17, 18 December 2020

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=NOREPINEPHRINE NOREPINEPHRINE] ==
+== Pathway PWY66-241 ==
+* taxonomic-range:
+** tax-40674
 * common-name:
-** (r)-noradrenaline
+** bupropion degradation
-* smiles:
+== Reaction(s) found ==
-** c1(c=c(o)c(=cc=1c(c[n+])o)o)
+* [[RXN66-181]]
-* inchi-key:
+== Reaction(s) not found ==
-** sflshlfxelfnjz-qmmmgpobsa-o
+* [NoneRXN66-182 RXN66-182]
-* molecular-weight:
+* [NoneRXN66-185 RXN66-185]
-** 170.188
+* [NoneRXN66-183 RXN66-183]
-== Reaction(s) known to consume the compound ==
+* [NoneRXN66-184 RXN66-184]
-* [[RXN-10907]]
+{{#set: taxonomic-range=tax-40674}}
-== Reaction(s) known to produce the compound ==
+{{#set: common-name=bupropion degradation}}
-* [[DOPAMINE-BETA-MONOOXYGENASE-RXN]]
+{{#set: nb reaction found=1}}
-== Reaction(s) of unknown directionality ==
+{{#set: completion rate=0.2}}
-{{#set: common-name=(r)-noradrenaline}}
+{{#set: nb total reaction=5}}
-{{#set: inchi-key=inchikey=sflshlfxelfnjz-qmmmgpobsa-o}}
-{{#set: molecular-weight=170.188}}