Difference between revisions of "PWY-5268"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DEHYDROSPHINGANINE DEHYDROSPHINGANINE] == * common-name: ** 3-dehydrosphinganine * smiles: ** c...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-782 CPD-782] == * common-name: ** 3,4-dihydroxyphenylacetate * smiles: ** c([o-])(=o)cc1(c=...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-782 CPD-782] == |
* common-name: | * common-name: | ||
| − | ** 3- | + | ** 3,4-dihydroxyphenylacetate |
* smiles: | * smiles: | ||
| − | ** | + | ** c([o-])(=o)cc1(c=cc(=c(c=1)o)o) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** cffzdzcdufsofz-uhfffaoysa-m |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 167.141 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN6666-5]] |
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name=3- | + | {{#set: common-name=3,4-dihydroxyphenylacetate}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=cffzdzcdufsofz-uhfffaoysa-m}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=167.141}} |
Revision as of 14:18, 26 August 2019
Contents
Metabolite CPD-782
- common-name:
- 3,4-dihydroxyphenylacetate
- smiles:
- c([o-])(=o)cc1(c=cc(=c(c=1)o)o)
- inchi-key:
- cffzdzcdufsofz-uhfffaoysa-m
- molecular-weight:
- 167.141
