Difference between revisions of "PWY-5278"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=LIOTHYRONINE LIOTHYRONINE] == * common-name: ** 3,5,3'-triiodo-l-thyronine * smiles: ** c1(c=c(...")
(Created page with "Category:pathway == Pathway PWY-5278 == * taxonomic-range: ** tax-2 * common-name: ** sulfite oxidation iii == Reaction(s) found == * ADENYLYLSULFATE-REDUCTASE-RXN * [...")
 
(7 intermediate revisions by 2 users not shown)
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=LIOTHYRONINE LIOTHYRONINE] ==
+
== Pathway PWY-5278 ==
 +
* taxonomic-range:
 +
** tax-2
 
* common-name:
 
* common-name:
** 3,5,3'-triiodo-l-thyronine
+
** sulfite oxidation iii
* smiles:
+
== Reaction(s) found ==
** c1(c=c(o)c(i)=cc=1oc2(=c(i)c=c(c=c(i)2)cc([n+])c(=o)[o-]))
+
* [[ADENYLYLSULFATE-REDUCTASE-RXN]]
* inchi-key:
+
* [[SULFATE-ADENYLYLTRANS-RXN]]
** auyycjsjgjycds-lbprgkrzsa-n
+
== Reaction(s) not found ==
* molecular-weight:
+
All reactions of this pathways are in present
** 650.978
+
{{#set: taxonomic-range=tax-2}}
== Reaction(s) known to consume the compound ==
+
{{#set: common-name=sulfite oxidation iii}}
* [[RXN-10607]]
+
{{#set: nb reaction found=2}}
* [[RXN-10609]]
+
{{#set: completion rate=1.0}}
* [[RXN-10615]]
+
{{#set: nb total reaction=2}}
== Reaction(s) known to produce the compound ==
 
== Reaction(s) of unknown directionality ==
 
{{#set: common-name=3,5,3'-triiodo-l-thyronine}}
 
{{#set: inchi-key=inchikey=auyycjsjgjycds-lbprgkrzsa-n}}
 
{{#set: molecular-weight=650.978}}
 

Latest revision as of 10:58, 18 March 2021

Pathway PWY-5278

  • taxonomic-range:
    • tax-2
  • common-name:
    • sulfite oxidation iii

Reaction(s) found

Reaction(s) not found

All reactions of this pathways are in present