Difference between revisions of "PWY-5278"

Revision as of 20:16, 18 December 2020

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=LIOTHYRONINE LIOTHYRONINE] ==
+== Pathway PWY6666-2 ==
+* taxonomic-range:
+** tax-33208
 * common-name:
-** 3,5,3'-triiodo-l-thyronine
+** dopamine degradation
-* smiles:
+== Reaction(s) found ==
-** c1(c=c(o)c(i)=cc=1oc2(=c(i)c=c(c=c(i)2)cc([n+])c(=o)[o-]))
+* [[RXN6666-4]]
-* inchi-key:
+* [[RXN6666-5]]
-** auyycjsjgjycds-lbprgkrzsa-n
+* [[RXN6666-9]]
-* molecular-weight:
+== Reaction(s) not found ==
-** 650.978
+* [NoneRXN6666-7 RXN6666-7]
-== Reaction(s) known to consume the compound ==
+* [NoneRXN6666-6 RXN6666-6]
-* [[RXN-10607]]
+{{#set: taxonomic-range=tax-33208}}
-* [[RXN-10609]]
+{{#set: common-name=dopamine degradation}}
-* [[RXN-10615]]
+{{#set: nb reaction found=3}}
-== Reaction(s) known to produce the compound ==
+{{#set: completion rate=0.6}}
-== Reaction(s) of unknown directionality ==
+{{#set: nb total reaction=5}}
-{{#set: common-name=3,5,3'-triiodo-l-thyronine}}
-{{#set: inchi-key=inchikey=auyycjsjgjycds-lbprgkrzsa-n}}
-{{#set: molecular-weight=650.978}}