Difference between revisions of "PWY-5278"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GERANYL-PP GERANYL-PP] == * common-name: ** geranyl diphosphate * smiles: ** cc(=cccc(=ccop([o-...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=LIOTHYRONINE LIOTHYRONINE] == * common-name: ** 3,5,3'-triiodo-l-thyronine * smiles: ** c1(c=c(...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=LIOTHYRONINE LIOTHYRONINE] == |
* common-name: | * common-name: | ||
| − | ** | + | ** 3,5,3'-triiodo-l-thyronine |
* smiles: | * smiles: | ||
| − | ** cc(= | + | ** c1(c=c(o)c(i)=cc=1oc2(=c(i)c=c(c=c(i)2)cc([n+])c(=o)[o-])) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** auyycjsjgjycds-lbprgkrzsa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 650.978 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN-10607]] |
| − | * [[ | + | * [[RXN-10609]] |
| − | * [[ | + | * [[RXN-10615]] |
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=3,5,3'-triiodo-l-thyronine}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=auyycjsjgjycds-lbprgkrzsa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=650.978}} |
Revision as of 09:22, 27 August 2019
Contents
Metabolite LIOTHYRONINE
- common-name:
- 3,5,3'-triiodo-l-thyronine
- smiles:
- c1(c=c(o)c(i)=cc=1oc2(=c(i)c=c(c=c(i)2)cc([n+])c(=o)[o-]))
- inchi-key:
- auyycjsjgjycds-lbprgkrzsa-n
- molecular-weight:
- 650.978
