Difference between revisions of "PWY-5279"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DIPEPTIDES DIPEPTIDES] == * common-name: ** a dipeptide == Reaction(s) known to consume the com...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11876 CPD-11876] == * common-name: ** 3-methoxy-4-hydroxyphenylglycolaldehyde * smiles: **...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11876 CPD-11876] == |
* common-name: | * common-name: | ||
| − | ** | + | ** 3-methoxy-4-hydroxyphenylglycolaldehyde |
| + | * smiles: | ||
| + | ** coc1(=c(o)c=cc(c(o)c=o)=c1) | ||
| + | * inchi-key: | ||
| + | ** visajvapypfkcl-qmmmgpobsa-n | ||
| + | * molecular-weight: | ||
| + | ** 182.176 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN-10915]] |
| + | * [[RXN-10917]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN-10910]] |
| − | * [[ | + | * [[RXN-10913]] |
| + | * [[RXN-10915]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=3-methoxy-4-hydroxyphenylglycolaldehyde}} |
| + | {{#set: inchi-key=inchikey=visajvapypfkcl-qmmmgpobsa-n}} | ||
| + | {{#set: molecular-weight=182.176}} | ||
Revision as of 09:22, 27 August 2019
Contents
Metabolite CPD-11876
- common-name:
- 3-methoxy-4-hydroxyphenylglycolaldehyde
- smiles:
- coc1(=c(o)c=cc(c(o)c=o)=c1)
- inchi-key:
- visajvapypfkcl-qmmmgpobsa-n
- molecular-weight:
- 182.176
