Difference between revisions of "PWY-5285"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9612 CPD-9612] == * common-name: ** caldariellaquinone * smiles: ** cc(c)cccc(c)cccc(c)cccc...")
(Created page with "Category:pathway == Pathway PWY-5285 == * taxonomic-range: ** tax-1224 * common-name: ** sulfide oxidation iii (persulfide dioxygenase) == Reaction(s) found == * FESGSHT...")
 
(8 intermediate revisions by 3 users not shown)
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9612 CPD-9612] ==
+
== Pathway PWY-5285 ==
 +
* taxonomic-range:
 +
** tax-1224
 
* common-name:
 
* common-name:
** caldariellaquinone
+
** sulfide oxidation iii (persulfide dioxygenase)
* smiles:
+
== Reaction(s) found ==
** cc(c)cccc(c)cccc(c)cccc(c)cccc(c)cccc(c)ccc2(=c(sc)c(=o)c1(=c(sc=c1)c(=o)2))
+
* [[FESGSHTHIO-RXN]]
* inchi-key:
+
== Reaction(s) not found ==
** ghrwxpxobgrshg-uhfffaoysa-n
+
* [NoneRXN-20884 RXN-20884]
* molecular-weight:
+
* [NoneRXN-16574 RXN-16574]
** 631.069
+
* [NoneR17-RXN R17-RXN]
== Reaction(s) known to consume the compound ==
+
{{#set: taxonomic-range=tax-1224}}
* [[RXN-15378]]
+
{{#set: common-name=sulfide oxidation iii (persulfide dioxygenase)}}
== Reaction(s) known to produce the compound ==
+
{{#set: nb reaction found=1}}
== Reaction(s) of unknown directionality ==
+
{{#set: completion rate=0.25}}
{{#set: common-name=caldariellaquinone}}
+
{{#set: nb total reaction=4}}
{{#set: inchi-key=inchikey=ghrwxpxobgrshg-uhfffaoysa-n}}
 
{{#set: molecular-weight=631.069}}
 

Latest revision as of 10:58, 18 March 2021

Pathway PWY-5285

  • taxonomic-range:
    • tax-1224
  • common-name:
    • sulfide oxidation iii (persulfide dioxygenase)

Reaction(s) found

Reaction(s) not found

  • [NoneRXN-20884 RXN-20884]
  • [NoneRXN-16574 RXN-16574]
  • [NoneR17-RXN R17-RXN]