Difference between revisions of "PWY-5285"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17375 CPD-17375] == * common-name: ** 1-[18-hydroxyoeoyl]-2-[18-hydroxy-lioleoyl]-sn-glycer...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9612 CPD-9612] == * common-name: ** caldariellaquinone * smiles: ** cc(c)cccc(c)cccc(c)cccc...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17375 CPD-17375] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9612 CPD-9612] ==
 
* common-name:
 
* common-name:
** 1-[18-hydroxyoeoyl]-2-[18-hydroxy-lioleoyl]-sn-glycerol
+
** caldariellaquinone
 
* smiles:
 
* smiles:
** c(o)cccccccc=ccccccccc(occ(oc(=o)cccccccc=ccc=cccccco)co)=o
+
** cc(c)cccc(c)cccc(c)cccc(c)cccc(c)cccc(c)ccc2(=c(sc)c(=o)c1(=c(sc=c1)c(=o)2))
 
* inchi-key:
 
* inchi-key:
** rcalbbvhqnuwno-osfdyrcisa-n
+
** ghrwxpxobgrshg-uhfffaoysa-n
 
* molecular-weight:
 
* molecular-weight:
** 650.978
+
** 631.069
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-15378]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-16121]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=1-[18-hydroxyoeoyl]-2-[18-hydroxy-lioleoyl]-sn-glycerol}}
+
{{#set: common-name=caldariellaquinone}}
{{#set: inchi-key=inchikey=rcalbbvhqnuwno-osfdyrcisa-n}}
+
{{#set: inchi-key=inchikey=ghrwxpxobgrshg-uhfffaoysa-n}}
{{#set: molecular-weight=650.978}}
+
{{#set: molecular-weight=631.069}}

Revision as of 14:18, 26 August 2019

Metabolite CPD-9612

  • common-name:
    • caldariellaquinone
  • smiles:
    • cc(c)cccc(c)cccc(c)cccc(c)cccc(c)cccc(c)ccc2(=c(sc)c(=o)c1(=c(sc=c1)c(=o)2))
  • inchi-key:
    • ghrwxpxobgrshg-uhfffaoysa-n
  • molecular-weight:
    • 631.069

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality