Difference between revisions of "PWY-5285"

Latest revision as of 10:58, 18 March 2021

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17375 CPD-17375] ==
+== Pathway PWY-5285 ==
+* taxonomic-range:
+** tax-1224
 * common-name:
-** 1-[18-hydroxyoeoyl]-2-[18-hydroxy-lioleoyl]-sn-glycerol
+** sulfide oxidation iii (persulfide dioxygenase)
-* smiles:
+== Reaction(s) found ==
-** c(o)cccccccc=ccccccccc(occ(oc(=o)cccccccc=ccc=cccccco)co)=o
+* [[FESGSHTHIO-RXN]]
-* inchi-key:
+== Reaction(s) not found ==
-** rcalbbvhqnuwno-osfdyrcisa-n
+* [NoneRXN-20884 RXN-20884]
-* molecular-weight:
+* [NoneRXN-16574 RXN-16574]
-** 650.978
+* [NoneR17-RXN R17-RXN]
-== Reaction(s) known to consume the compound ==
+{{#set: taxonomic-range=tax-1224}}
-== Reaction(s) known to produce the compound ==
+{{#set: common-name=sulfide oxidation iii (persulfide dioxygenase)}}
-* [[RXN-16121]]
+{{#set: nb reaction found=1}}
-== Reaction(s) of unknown directionality ==
+{{#set: completion rate=0.25}}
-{{#set: common-name=1-[18-hydroxyoeoyl]-2-[18-hydroxy-lioleoyl]-sn-glycerol}}
+{{#set: nb total reaction=4}}
-{{#set: inchi-key=inchikey=rcalbbvhqnuwno-osfdyrcisa-n}}
-{{#set: molecular-weight=650.978}}