Difference between revisions of "PWY-5316"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-730 CPD-730] == * common-name: ** 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-octanoate * smil...")
(Created page with "Category:pathway == Pathway PWY-5316 == * taxonomic-range: ** tax-4070 * common-name: ** nicotine biosynthesis == Reaction(s) found == * L-ASPARTATE-OXID-RXN * QUINO...")
 
(7 intermediate revisions by 3 users not shown)
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-730 CPD-730] ==
+
== Pathway PWY-5316 ==
 +
* taxonomic-range:
 +
** tax-4070
 
* common-name:
 
* common-name:
** 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-octanoate
+
** nicotine biosynthesis
* smiles:
+
== Reaction(s) found ==
** ccc=ccc1(c(ccc(=o)1)cccccccc([o-])=o)
+
* [[L-ASPARTATE-OXID-RXN]]
* inchi-key:
+
* [[QUINOLINATE-SYNTHA-RXN]]
** bzxzfdkirzbjep-jmtmcxqrsa-m
+
* [[QUINOPRIBOTRANS-RXN]]
* molecular-weight:
+
== Reaction(s) not found ==
** 293.425
+
* [NoneRXN-13060 RXN-13060]
== Reaction(s) known to consume the compound ==
+
* [NoneRXN-13057 RXN-13057]
== Reaction(s) known to produce the compound ==
+
* [NoneRXN-13058 RXN-13058]
* [[12-OXOPHYTODIENOATE-REDUCTASE-RXN]]
+
* [NoneRXN-13059 RXN-13059]
== Reaction(s) of unknown directionality ==
+
* [NoneRXN-8444 RXN-8444]
{{#set: common-name=3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-octanoate}}
+
* [NoneRXN-8248 RXN-8248]
{{#set: inchi-key=inchikey=bzxzfdkirzbjep-jmtmcxqrsa-m}}
+
{{#set: taxonomic-range=tax-4070}}
{{#set: molecular-weight=293.425}}
+
{{#set: common-name=nicotine biosynthesis}}
 +
{{#set: nb reaction found=3}}
 +
{{#set: completion rate=0.33}}
 +
{{#set: nb total reaction=9}}

Latest revision as of 10:59, 18 March 2021

Pathway PWY-5316

  • taxonomic-range:
    • tax-4070
  • common-name:
    • nicotine biosynthesis

Reaction(s) found

Reaction(s) not found

  • [NoneRXN-13060 RXN-13060]
  • [NoneRXN-13057 RXN-13057]
  • [NoneRXN-13058 RXN-13058]
  • [NoneRXN-13059 RXN-13059]
  • [NoneRXN-8444 RXN-8444]
  • [NoneRXN-8248 RXN-8248]