Difference between revisions of "PWY-5316"

Revision as of 09:22, 27 August 2019

@@ Line 1: / Line 1: @@
 [[Category:metabolite]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GLYCEROL GLYCEROL] ==
+== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-730 CPD-730] ==
 * common-name:
-** glycerol
+** 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-octanoate
 * smiles:
-** c(c(o)co)o
+** ccc=ccc1(c(ccc(=o)1)cccccccc([o-])=o)
 * inchi-key:
-** pedcqbhivmgvhv-uhfffaoysa-n
+** bzxzfdkirzbjep-jmtmcxqrsa-m
 * molecular-weight:
-** 92.094
+** 293.425
 == Reaction(s) known to consume the compound ==
-* [[ALCD19]]
-* [[GLYCEROL-DEHYDRATASE-RXN]]
-* [[GLYCEROL-DEHYDROGENASE-NADP+-RXN]]
-* [[GLYCEROL-KIN-RXN]]
-* [[biomass_rxn]]
 == Reaction(s) known to produce the compound ==
-* [[3.1.1.23-RXN]]
+* [[12-OXOPHYTODIENOATE-REDUCTASE-RXN]]
-* [[ALCD19]]
-* [[CARDIOLIPSYN-RXN]]
-* [[GLYCEROL-1-PHOSPHATASE-RXN]]
-* [[GLYCEROL-DEHYDROGENASE-NADP+-RXN]]
-* [[GLYCEROL-KIN-RXN]]
-* [[RXN-14073]]
-* [[RXN-14964]]
-* [[RXN-14965]]
-* [[RXN-15088]]
-* [[RXN-15089]]
-* [[RXN-7952-CPD66-43/WATER//GLYCEROL/PALMITATE/PROTON.42.]]
 == Reaction(s) of unknown directionality ==
-{{#set: common-name=glycerol}}
+{{#set: common-name=3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-octanoate}}
-{{#set: inchi-key=inchikey=pedcqbhivmgvhv-uhfffaoysa-n}}
+{{#set: inchi-key=inchikey=bzxzfdkirzbjep-jmtmcxqrsa-m}}
-{{#set: molecular-weight=92.094}}
+{{#set: molecular-weight=293.425}}