Difference between revisions of "PWY-5316"

Revision as of 20:18, 18 December 2020

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-730 CPD-730] ==
+== Pathway PWY-7118 ==
+* taxonomic-range:
+** tax-33154
 * common-name:
-** 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-octanoate
+** chitin degradation to ethanol
-* smiles:
+== Reaction(s) found ==
-** ccc=ccc1(c(ccc(=o)1)cccccccc([o-])=o)
+* [[1.1.1.39-RXN]]
-* inchi-key:
+* [[ACETATE--COA-LIGASE-RXN]]
-** bzxzfdkirzbjep-jmtmcxqrsa-m
+* [[ALCOHOL-DEHYDROG-RXN]]
-* molecular-weight:
+* [[CHITIN-DEACETYLASE-RXN]]
-** 293.425
+* [[MALSYN-RXN]]
-== Reaction(s) known to consume the compound ==
+== Reaction(s) not found ==
-== Reaction(s) known to produce the compound ==
+* [NoneRXN-6161 RXN-6161]
-* [[12-OXOPHYTODIENOATE-REDUCTASE-RXN]]
+{{#set: taxonomic-range=tax-33154}}
-== Reaction(s) of unknown directionality ==
+{{#set: common-name=chitin degradation to ethanol}}
-{{#set: common-name=3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-octanoate}}
+{{#set: nb reaction found=5}}
-{{#set: inchi-key=inchikey=bzxzfdkirzbjep-jmtmcxqrsa-m}}
+{{#set: completion rate=0.83}}
-{{#set: molecular-weight=293.425}}
+{{#set: nb total reaction=6}}