Difference between revisions of "PWY-5320"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15657 CPD-15657] == * common-name: ** (3r)-hydroxy-undecanoyl-coa * smiles: ** ccccccccc(o)...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PROTEIN-L-CITRULLINE PROTEIN-L-CITRULLINE] == * common-name: ** a [protein]-l-citrulline == Rea...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15657 CPD-15657] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PROTEIN-L-CITRULLINE PROTEIN-L-CITRULLINE] ==
 
* common-name:
 
* common-name:
** (3r)-hydroxy-undecanoyl-coa
+
** a [protein]-l-citrulline
* smiles:
 
** ccccccccc(o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 
* inchi-key:
 
** jiogxinzsoqege-mawalykisa-j
 
* molecular-weight:
 
** 947.78
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-14778]]
+
* [[PROTEIN-ARGININE-DEIMINASE-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(3r)-hydroxy-undecanoyl-coa}}
+
{{#set: common-name=a [protein]-l-citrulline}}
{{#set: inchi-key=inchikey=jiogxinzsoqege-mawalykisa-j}}
 
{{#set: molecular-weight=947.78}}
 

Revision as of 14:19, 26 August 2019

Metabolite PROTEIN-L-CITRULLINE

  • common-name:
    • a [protein]-l-citrulline

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "a [protein]-l-citrulline" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.