Difference between revisions of "PWY-5337"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17045 CPD-17045] == * common-name: ** 3-benzyl-3,6-dihydroxy-6-(hydroxymethyl)-diketopipera...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=HISTIDINAL HISTIDINAL] == * common-name: ** histidinal * smiles: ** c1(nc=nc=1cc([ch]=o)[n+]) *...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17045 CPD-17045] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=HISTIDINAL HISTIDINAL] ==
 
* common-name:
 
* common-name:
** 3-benzyl-3,6-dihydroxy-6-(hydroxymethyl)-diketopiperazine
+
** histidinal
 
* smiles:
 
* smiles:
** c(o)c2(o)(nc(=o)c(o)(cc1(=cc=cc=c1))nc(=o)2)
+
** c1(nc=nc=1cc([ch]=o)[n+])
 
* inchi-key:
 
* inchi-key:
** pxypzmrmtkvysm-vxgbxaggsa-n
+
** vyoielonwkizjs-yfkpbyrvsa-o
 
* molecular-weight:
 
* molecular-weight:
** 266.253
+
** 140.164
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-15680]]
+
* [[HISTALDEHYD-RXN]]
 +
* [[HISTOLDEHYD-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[HISTOLDEHYD-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=3-benzyl-3,6-dihydroxy-6-(hydroxymethyl)-diketopiperazine}}
+
{{#set: common-name=histidinal}}
{{#set: inchi-key=inchikey=pxypzmrmtkvysm-vxgbxaggsa-n}}
+
{{#set: inchi-key=inchikey=vyoielonwkizjs-yfkpbyrvsa-o}}
{{#set: molecular-weight=266.253}}
+
{{#set: molecular-weight=140.164}}

Revision as of 09:22, 27 August 2019

Metabolite HISTIDINAL

  • common-name:
    • histidinal
  • smiles:
    • c1(nc=nc=1cc([ch]=o)[n+])
  • inchi-key:
    • vyoielonwkizjs-yfkpbyrvsa-o
  • molecular-weight:
    • 140.164

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality