Difference between revisions of "PWY-5338"

Latest revision as of 11:00, 18 March 2021

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14423 CPD-14423] ==
+== Pathway PWY-5338 ==
+* taxonomic-range:
+** tax-3803
 * common-name:
-** 3-oxo-docosapentaenoyl-coa
+** galactosylcyclitol biosynthesis
-* smiles:
+== Reaction(s) found ==
-** ccc=ccc=ccc=ccc=ccc=ccccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
+* [[RXN-8281]]
-* inchi-key:
+== Reaction(s) not found ==
-** slykkqsprfjdaf-hvganwhpsa-j
+* [NoneRXN-8277 RXN-8277]
-* molecular-weight:
+* [NoneRXN-8278 RXN-8278]
-** 1089.98
+* [NoneRXN-8279 RXN-8279]
-== Reaction(s) known to consume the compound ==
+{{#set: taxonomic-range=tax-3803}}
-* [[RXN-13443]]
+{{#set: common-name=galactosylcyclitol biosynthesis}}
-== Reaction(s) known to produce the compound ==
+{{#set: nb reaction found=1}}
-== Reaction(s) of unknown directionality ==
+{{#set: completion rate=0.25}}
-{{#set: common-name=3-oxo-docosapentaenoyl-coa}}
+{{#set: nb total reaction=4}}
-{{#set: inchi-key=inchikey=slykkqsprfjdaf-hvganwhpsa-j}}
-{{#set: molecular-weight=1089.98}}