Difference between revisions of "PWY-5367"

Revision as of 09:22, 27 August 2019

@@ Line 1: / Line 1: @@
 [[Category:metabolite]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=THR THR] ==
+== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8355 CPD-8355] ==
 * common-name:
-** l-threonine
+** 1-18:1-2-lysophosphatidylethanolamine
 * smiles:
-** cc(o)c([n+])c(=o)[o-]
+** ccccccccc=ccccccccc(occ(o)cop([o-])(=o)occ[n+])=o
 * inchi-key:
-** ayfvyjqapqtccc-gbxijsldsa-n
+** pyvrvrfvlrnjly-mzmpxxgtsa-n
 * molecular-weight:
-** 119.12
+** 479.593
 == Reaction(s) known to consume the compound ==
-* [[RXN-14249]]
+* [[RXN-15035]]
-* [[RXN-14569]]
+* [[RXN-15036]]
-* [[RXN-15122]]
-* [[THREDEHYD-RXN]]
-* [[THREODEHYD-RXN]]
-* [[THREONINE--TRNA-LIGASE-RXN]]
-* [[THREONINE-ALDOLASE-RXN]]
-* [[biomass_rxn]]
 == Reaction(s) known to produce the compound ==
-* [[RXN-14569]]
+* [[RXN-15036]]
-* [[RXN-15122]]
+* [[RXN-15067]]
-* [[RXN0-6980]]
-* [[THRESYN-RXN]]
 == Reaction(s) of unknown directionality ==
-{{#set: common-name=l-threonine}}
+{{#set: common-name=1-18:1-2-lysophosphatidylethanolamine}}
-{{#set: inchi-key=inchikey=ayfvyjqapqtccc-gbxijsldsa-n}}
+{{#set: inchi-key=inchikey=pyvrvrfvlrnjly-mzmpxxgtsa-n}}
-{{#set: molecular-weight=119.12}}
+{{#set: molecular-weight=479.593}}