Difference between revisions of "PWY-5403"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10330 CPD-10330] == * common-name: ** α-d-ribofuranose * smiles: ** c(c1(c(c(c(o1)o)o...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=7-METHYLXANTHINE 7-METHYLXANTHINE] == * common-name: ** 7-methylxanthine * smiles: ** cn1(c=nc2...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=7-METHYLXANTHINE 7-METHYLXANTHINE] == |
* common-name: | * common-name: | ||
| − | ** | + | ** 7-methylxanthine |
* smiles: | * smiles: | ||
| − | ** | + | ** cn1(c=nc2(nc(=o)nc(=o)c1=2)) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** pfwlfwpasulgan-uhfffaoysa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 166.139 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN-11521]] |
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=7-methylxanthine}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=pfwlfwpasulgan-uhfffaoysa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=166.139}} |
Revision as of 14:18, 26 August 2019
Contents
Metabolite 7-METHYLXANTHINE
- common-name:
- 7-methylxanthine
- smiles:
- cn1(c=nc2(nc(=o)nc(=o)c1=2))
- inchi-key:
- pfwlfwpasulgan-uhfffaoysa-n
- molecular-weight:
- 166.139
