Difference between revisions of "PWY-5406"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-157 CPD-157] == * common-name: ** (2z,4e)-2-hydroxy-6-oxonona-2,4-diene-1,9-dioate * smiles...")
 
(Created page with "Category:pathway == Pathway PWY-5406 == * taxonomic-range: ** tax-33090 * common-name: ** divinyl ether biosynthesis i == Reaction(s) found == * RXN-8497 == Reaction(s...")
 
(9 intermediate revisions by 5 users not shown)
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-157 CPD-157] ==
+
== Pathway PWY-5406 ==
 +
* taxonomic-range:
 +
** tax-33090
 
* common-name:
 
* common-name:
** (2z,4e)-2-hydroxy-6-oxonona-2,4-diene-1,9-dioate
+
** divinyl ether biosynthesis i
* smiles:
+
== Reaction(s) found ==
** c([o-])(=o)ccc(=o)c=cc=c(c([o-])=o)o
+
* [[RXN-8497]]
* inchi-key:
+
== Reaction(s) not found ==
** rfenovfrmprrji-ydcwotkksa-l
+
* [NoneRXN-8495 RXN-8495]
* molecular-weight:
+
* [NoneRXN-8496 RXN-8496]
** 212.159
+
* [NoneRXN-8498 RXN-8498]
== Reaction(s) known to consume the compound ==
+
{{#set: taxonomic-range=tax-33090}}
* [[MHPCHYDROL-RXN]]
+
{{#set: common-name=divinyl ether biosynthesis i}}
== Reaction(s) known to produce the compound ==
+
{{#set: nb reaction found=1}}
== Reaction(s) of unknown directionality ==
+
{{#set: completion rate=0.25}}
{{#set: common-name=(2z,4e)-2-hydroxy-6-oxonona-2,4-diene-1,9-dioate}}
+
{{#set: nb total reaction=4}}
{{#set: inchi-key=inchikey=rfenovfrmprrji-ydcwotkksa-l}}
 
{{#set: molecular-weight=212.159}}
 

Latest revision as of 10:57, 18 March 2021

Pathway PWY-5406

  • taxonomic-range:
    • tax-33090
  • common-name:
    • divinyl ether biosynthesis i

Reaction(s) found

Reaction(s) not found

  • [NoneRXN-8495 RXN-8495]
  • [NoneRXN-8496 RXN-8496]
  • [NoneRXN-8498 RXN-8498]