Difference between revisions of "PWY-5406"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-157 CPD-157] == * common-name: ** (2z,4e)-2-hydroxy-6-oxonona-2,4-diene-1,9-dioate * smiles...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-Fucopyranoses L-Fucopyranoses] == * common-name: ** l-fucopyranose == Reaction(s) known to co...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-157 CPD-157] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-Fucopyranoses L-Fucopyranoses] ==
 
* common-name:
 
* common-name:
** (2z,4e)-2-hydroxy-6-oxonona-2,4-diene-1,9-dioate
+
** l-fucopyranose
* smiles:
 
** c([o-])(=o)ccc(=o)c=cc=c(c([o-])=o)o
 
* inchi-key:
 
** rfenovfrmprrji-ydcwotkksa-l
 
* molecular-weight:
 
** 212.159
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[MHPCHYDROL-RXN]]
+
* [[FUCOKINASE-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(2z,4e)-2-hydroxy-6-oxonona-2,4-diene-1,9-dioate}}
+
{{#set: common-name=l-fucopyranose}}
{{#set: inchi-key=inchikey=rfenovfrmprrji-ydcwotkksa-l}}
 
{{#set: molecular-weight=212.159}}
 

Revision as of 14:18, 26 August 2019

Metabolite L-Fucopyranoses

  • common-name:
    • l-fucopyranose

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality