Difference between revisions of "PWY-5409"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15365 CPD-15365] == * common-name: ** densipoloyl-coa * smiles: ** ccc=cccc(o)cc=ccccccccc(...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPDQT-28 CPDQT-28] == * common-name: ** 7-(methylthio)-2-oxoheptanoate * smiles: ** cscccccc(=o...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15365 CPD-15365] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPDQT-28 CPDQT-28] ==
 
* common-name:
 
* common-name:
** densipoloyl-coa
+
** 7-(methylthio)-2-oxoheptanoate
 
* smiles:
 
* smiles:
** ccc=cccc(o)cc=ccccccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
+
** cscccccc(=o)c([o-])=o
 
* inchi-key:
 
* inchi-key:
** qebzgoipmjeisg-apevuuacsa-j
+
** twaioppflzexco-uhfffaoysa-m
 
* molecular-weight:
 
* molecular-weight:
** 1041.936
+
** 189.249
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-16150]]
 
* [[RXN-16153]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-16150]]
+
* [[RXNQT-4168]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=densipoloyl-coa}}
+
{{#set: common-name=7-(methylthio)-2-oxoheptanoate}}
{{#set: inchi-key=inchikey=qebzgoipmjeisg-apevuuacsa-j}}
+
{{#set: inchi-key=inchikey=twaioppflzexco-uhfffaoysa-m}}
{{#set: molecular-weight=1041.936}}
+
{{#set: molecular-weight=189.249}}

Revision as of 09:22, 27 August 2019

Metabolite CPDQT-28

  • common-name:
    • 7-(methylthio)-2-oxoheptanoate
  • smiles:
    • cscccccc(=o)c([o-])=o
  • inchi-key:
    • twaioppflzexco-uhfffaoysa-m
  • molecular-weight:
    • 189.249

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality