Difference between revisions of "PWY-5429"

Latest revision as of 10:59, 18 March 2021

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12904 CPD-12904] ==
+== Pathway PWY-5429 ==
+* taxonomic-range:
+** tax-2
 * common-name:
-** (2e)-5-methylhexa-2,4-dienoyl-coa
+** p-xylene degradation to p-toluate
-* smiles:
+== Reaction(s) found ==
-** cc(c)=cc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
+* [[RXN-8582]]
-* inchi-key:
+== Reaction(s) not found ==
-** ifmyvrqehqtins-meoyllpmsa-j
+* [NoneRXN-8579 RXN-8579]
-* molecular-weight:
+* [NoneRXN-8581 RXN-8581]
-** 871.642
+{{#set: taxonomic-range=tax-2}}
-== Reaction(s) known to consume the compound ==
+{{#set: common-name=p-xylene degradation to p-toluate}}
-* [[RXN-11919]]
+{{#set: nb reaction found=1}}
-== Reaction(s) known to produce the compound ==
+{{#set: completion rate=0.33}}
-== Reaction(s) of unknown directionality ==
+{{#set: nb total reaction=3}}
-{{#set: common-name=(2e)-5-methylhexa-2,4-dienoyl-coa}}
-{{#set: inchi-key=inchikey=ifmyvrqehqtins-meoyllpmsa-j}}
-{{#set: molecular-weight=871.642}}