Difference between revisions of "PWY-5429"

Revision as of 20:18, 18 December 2020

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12904 CPD-12904] ==
+== Pathway PWY-7170 ==
+* taxonomic-range:
+** tax-3041
+** tax-33090
 * common-name:
-** (2e)-5-methylhexa-2,4-dienoyl-coa
+** phytochromobilin biosynthesis
-* smiles:
+== Reaction(s) found ==
-** cc(c)=cc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
+* [[1.3.7.4-RXN]]
-* inchi-key:
+* [[RXN-17523]]
-** ifmyvrqehqtins-meoyllpmsa-j
+== Reaction(s) not found ==
-* molecular-weight:
+* [NoneRXN-13968 RXN-13968]
-** 871.642
+{{#set: taxonomic-range=tax-33090|tax-3041}}
-== Reaction(s) known to consume the compound ==
+{{#set: common-name=phytochromobilin biosynthesis}}
-* [[RXN-11919]]
+{{#set: nb reaction found=2}}
-== Reaction(s) known to produce the compound ==
+{{#set: completion rate=0.67}}
-== Reaction(s) of unknown directionality ==
+{{#set: nb total reaction=3}}
-{{#set: common-name=(2e)-5-methylhexa-2,4-dienoyl-coa}}
-{{#set: inchi-key=inchikey=ifmyvrqehqtins-meoyllpmsa-j}}
-{{#set: molecular-weight=871.642}}