Difference between revisions of "PWY-5429"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Oxidized-hemoproteins Oxidized-hemoproteins] == * common-name: ** an oxidized hemoprotein == Re...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12904 CPD-12904] == * common-name: ** (2e)-5-methylhexa-2,4-dienoyl-coa * smiles: ** cc(c)=...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12904 CPD-12904] == |
* common-name: | * common-name: | ||
| − | ** | + | ** (2e)-5-methylhexa-2,4-dienoyl-coa |
| + | * smiles: | ||
| + | ** cc(c)=cc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-] | ||
| + | * inchi-key: | ||
| + | ** ifmyvrqehqtins-meoyllpmsa-j | ||
| + | * molecular-weight: | ||
| + | ** 871.642 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN-11919]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=(2e)-5-methylhexa-2,4-dienoyl-coa}} |
| + | {{#set: inchi-key=inchikey=ifmyvrqehqtins-meoyllpmsa-j}} | ||
| + | {{#set: molecular-weight=871.642}} | ||
Revision as of 09:22, 27 August 2019
Contents
Metabolite CPD-12904
- common-name:
- (2e)-5-methylhexa-2,4-dienoyl-coa
- smiles:
- cc(c)=cc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
- inchi-key:
- ifmyvrqehqtins-meoyllpmsa-j
- molecular-weight:
- 871.642
