Difference between revisions of "PWY-5436"

Latest revision as of 10:57, 18 March 2021

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ASN ASN] ==
+== Pathway PWY-5436 ==
+* taxonomic-range:
+** tax-2
+** tax-4751
 * common-name:
-** l-asparagine
+** l-threonine degradation iv
-* smiles:
+== Reaction(s) found ==
-** c(cc(c(=o)[o-])[n+])(n)=o
+* [[THREONINE-ALDOLASE-RXN]]
-* inchi-key:
+== Reaction(s) not found ==
-** dcxyfedjocdnaf-reohclbhsa-n
+* [NoneACETALD-DEHYDROG-RXN ACETALD-DEHYDROG-RXN]
-* molecular-weight:
+{{#set: taxonomic-range=tax-4751|tax-2}}
-** 132.119
+{{#set: common-name=l-threonine degradation iv}}
-== Reaction(s) known to consume the compound ==
+{{#set: nb reaction found=1}}
-* [[ASPARAGHYD-RXN]]
+{{#set: completion rate=0.5}}
-* [[ASPARAGINE--TRNA-LIGASE-RXN]]
+{{#set: nb total reaction=2}}
-* [[biomass_rxn]]
-== Reaction(s) known to produce the compound ==
-* [[ASNSYNA-RXN]]
-* [[ASNSYNB-RXN]]
-* [[RXN-12460]]
-* [[RXN0-6982]]
-== Reaction(s) of unknown directionality ==
-{{#set: common-name=l-asparagine}}
-{{#set: inchi-key=inchikey=dcxyfedjocdnaf-reohclbhsa-n}}
-{{#set: molecular-weight=132.119}}