Difference between revisions of "PWY-5436"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ASN ASN] == * common-name: ** l-asparagine * smiles: ** c(cc(c(=o)[o-])[n+])(n)=o * inchi-key:...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=i-Antigens i-Antigens] == * common-name: ** an i antigen == Reaction(s) known to consume the co...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=i-Antigens i-Antigens] == |
* common-name: | * common-name: | ||
| − | ** | + | ** an i antigen |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN-15276]] |
| − | |||
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=an i antigen}} |
| − | |||
| − | |||
Revision as of 09:22, 27 August 2019
Contents
Metabolite i-Antigens
- common-name:
- an i antigen
