Difference between revisions of "PWY-5437"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=tRNA-Adenosines-37 tRNA-Adenosines-37] == * common-name: ** an adenosine37 in trna == Reaction(...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=METHACRYLYL-COA METHACRYLYL-COA] == * common-name: ** methylacrylyl-coa * smiles: ** c=c(c(=o)s...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=METHACRYLYL-COA METHACRYLYL-COA] == |
* common-name: | * common-name: | ||
| − | ** | + | ** methylacrylyl-coa |
| + | * smiles: | ||
| + | ** c=c(c(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])c | ||
| + | * inchi-key: | ||
| + | ** npalueycdzwbov-ndzskpawsa-j | ||
| + | * molecular-weight: | ||
| + | ** 831.577 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[METHYLACYLYLCOA-HYDROXY-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[MCDH]] | ||
| + | * [[METHYLACYLYLCOA-HYDROXY-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=methylacrylyl-coa}} |
| + | {{#set: inchi-key=inchikey=npalueycdzwbov-ndzskpawsa-j}} | ||
| + | {{#set: molecular-weight=831.577}} | ||
Revision as of 14:19, 26 August 2019
Contents
Metabolite METHACRYLYL-COA
- common-name:
- methylacrylyl-coa
- smiles:
- c=c(c(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])c
- inchi-key:
- npalueycdzwbov-ndzskpawsa-j
- molecular-weight:
- 831.577
